C33H17N5O3 — CID 102007965
9,10-dioxo-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylanthracene-2-carboxamide (PubChem CID 102007965) has the molecular formula C33H17N5O3 and a molecular weight of 531.53 g/mol. Its IUPAC name is 9,10-dioxo-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylanthracene-2-carboxamide.
| Compound Name | 9,10-dioxo-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylanthracene-2-carboxamide |
|---|---|
| PubChem CID | 102007965 |
| Molecular Formula | C33H17N5O3 |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 9,10-dioxo-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylanthracene-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc3c4cccnc4c4ncccc4c3nc2c1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C33H17N5O3/c39-31-19-5-1-2-6-20(19)32(40)24-15-17(9-11-21(24)31)33(41)36-18-10-12-25-26(16-18)38-30-23-8-4-14-35-28(23)27-22(29(30)37-25)7-3-13-34-27/h1-16H,(H,36,41) |
| InChIKey | WODYOEINNOZMPF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|