C31H18N4O3 — CID 126343294
N-benzo[a]phenazin-10-yl-4-(1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 126343294) has the molecular formula C31H18N4O3 and a molecular weight of 494.51 g/mol. Its IUPAC name is N-benzo[a]phenazin-10-yl-4-(1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-benzo[a]phenazin-10-yl-4-(1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 126343294 |
| Molecular Formula | C31H18N4O3 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-benzo[a]phenazin-10-yl-4-(1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2nc3ccc4ccccc4c3nc2c1)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C31H18N4O3/c36-29(19-9-13-21(14-10-19)35-30(37)23-7-3-4-8-24(23)31(35)38)32-20-12-16-25-27(17-20)34-28-22-6-2-1-5-18(22)11-15-26(28)33-25/h1-17H,(H,32,36) |
| InChIKey | YGGGMJHNWQRWFP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|