C22H18N6O2 — CID 5030725
1-(3-hydroxypropyl)-3-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylurea (PubChem CID 5030725) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylurea.
| Compound Name | 1-(3-hydroxypropyl)-3-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylurea |
|---|---|
| PubChem CID | 5030725 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylurea |
| SMILES | O=C(NCCCO)Nc1ccc2nc3c4cccnc4c4ncccc4c3nc2c1 |
| InChI | InChI=1S/C22H18N6O2/c29-11-3-10-25-22(30)26-13-6-7-16-17(12-13)28-21-15-5-2-9-24-19(15)18-14(20(21)27-16)4-1-8-23-18/h1-2,4-9,12,29H,3,10-11H2,(H2,25,26,30) |
| InChIKey | VAEQSFGKQHSKGY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|