C14H17N3O2 — CID 110909304
1-(3-hydroxypropyl)-3-(quinolin-8-ylmethyl)urea (PubChem CID 110909304) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(quinolin-8-ylmethyl)urea.
| Compound Name | 1-(3-hydroxypropyl)-3-(quinolin-8-ylmethyl)urea |
|---|---|
| PubChem CID | 110909304 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(quinolin-8-ylmethyl)urea |
| SMILES | O=C(NCCCO)NCc1cccc2cccnc12 |
| InChI | InChI=1S/C14H17N3O2/c18-9-3-8-16-14(19)17-10-12-5-1-4-11-6-2-7-15-13(11)12/h1-2,4-7,18H,3,8-10H2,(H2,16,17,19) |
| InChIKey | ONEXOBBBSMPCMP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|