C32H22N8O2 — CID 102007967
2-[4-(dimethylcarbamoyl)-2-pyridinyl]-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpyridine-4-carboxamide (PubChem CID 102007967) has the molecular formula C32H22N8O2 and a molecular weight of 550.58 g/mol. Its IUPAC name is 2-[4-(dimethylcarbamoyl)-2-pyridinyl]-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpyridine-4-carboxamide.
| Compound Name | 2-[4-(dimethylcarbamoyl)-2-pyridinyl]-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 102007967 |
| Molecular Formula | C32H22N8O2 |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 2-[4-(dimethylcarbamoyl)-2-pyridinyl]-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpyridine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccnc(-c2cc(C(=O)Nc3ccc4nc5c6cccnc6c6ncccc6c5nc4c3)ccn2)c1 |
| InChI | InChI=1S/C32H22N8O2/c1-40(2)32(42)19-10-14-34-25(16-19)24-15-18(9-13-33-24)31(41)37-20-7-8-23-26(17-20)39-30-22-6-4-12-36-28(22)27-21(29(30)38-23)5-3-11-35-27/h3-17H,1-2H3,(H,37,41) |
| InChIKey | BUZRZYUSTQCXDX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|