C24H13N3O7 — CID 3681943
4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid (PubChem CID 3681943) has the molecular formula C24H13N3O7 and a molecular weight of 455.38 g/mol. Its IUPAC name is 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3681943 |
| Molecular Formula | C24H13N3O7 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc3c(c2)C(=O)N(N2C(=O)c4ccccc4C2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H13N3O7/c28-19(25-14-8-5-12(6-9-14)24(33)34)13-7-10-17-18(11-13)23(32)27(22(17)31)26-20(29)15-3-1-2-4-16(15)21(26)30/h1-11H,(H,25,28)(H,33,34) |
| InChIKey | ZMLQKZIYOUSRLJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|