C29H18N2O7 — CID 3945332
5-[[1,3-dioxo-2-(2-phenylphenyl)isoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 3945332) has the molecular formula C29H18N2O7 and a molecular weight of 506.47 g/mol. Its IUPAC name is 5-[[1,3-dioxo-2-(2-phenylphenyl)isoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[1,3-dioxo-2-(2-phenylphenyl)isoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 3945332 |
| Molecular Formula | C29H18N2O7 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 5-[[1,3-dioxo-2-(2-phenylphenyl)isoindole-5-carbonyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2-c2ccccc2)C3=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C29H18N2O7/c32-25(30-20-13-18(28(35)36)12-19(14-20)29(37)38)17-10-11-22-23(15-17)27(34)31(26(22)33)24-9-5-4-8-21(24)16-6-2-1-3-7-16/h1-15H,(H,30,32)(H,35,36)(H,37,38) |
| InChIKey | BVGSZOMGNISTGS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|