C21H34O4 — CID 159582066
methyl 2,2-dimethylbutanoate;phenyl 2-methylbutanoate;prop-1-ene (PubChem CID 159582066) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl 2,2-dimethylbutanoate;phenyl 2-methylbutanoate;prop-1-ene.
| Compound Name | methyl 2,2-dimethylbutanoate;phenyl 2-methylbutanoate;prop-1-ene |
|---|---|
| PubChem CID | 159582066 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl 2,2-dimethylbutanoate;phenyl 2-methylbutanoate;prop-1-ene |
| SMILES | C=CC.CCC(C)(C)C(=O)OC.CCC(C)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H14O2.C7H14O2.C3H6/c1-3-9(2)11(12)13-10-7-5-4-6-8-10;1-5-7(2,3)6(8)9-4;1-3-2/h4-9H,3H2,1-2H3;5H2,1-4H3;3H,1H2,2H3 |
| InChIKey | MJDJEKTVPXLXEI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|