C31H34O6 — CID 161424798
(6-hydroxynaphthalen-2-yl) 2,2-dimethylbutanoate;(6-hydroxynaphthalen-2-yl) 2-methylbutanoate (PubChem CID 161424798) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (6-hydroxynaphthalen-2-yl) 2,2-dimethylbutanoate;(6-hydroxynaphthalen-2-yl) 2-methylbutanoate.
| Compound Name | (6-hydroxynaphthalen-2-yl) 2,2-dimethylbutanoate;(6-hydroxynaphthalen-2-yl) 2-methylbutanoate |
|---|---|
| PubChem CID | 161424798 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (6-hydroxynaphthalen-2-yl) 2,2-dimethylbutanoate;(6-hydroxynaphthalen-2-yl) 2-methylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc2cc(O)ccc2c1.CCC(C)C(=O)Oc1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C16H18O3.C15H16O3/c1-4-16(2,3)15(18)19-14-8-6-11-9-13(17)7-5-12(11)10-14;1-3-10(2)15(17)18-14-7-5-11-8-13(16)6-4-12(11)9-14/h5-10,17H,4H2,1-3H3;4-10,16H,3H2,1-2H3 |
| InChIKey | VXFHMPADDFCWSB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|