C16H22O5 — CID 129105717
[5-(2,2-dimethylpropanoyloxy)-2-hydroxyphenyl] 2-methylbutanoate (PubChem CID 129105717) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoyloxy)-2-hydroxyphenyl] 2-methylbutanoate.
| Compound Name | [5-(2,2-dimethylpropanoyloxy)-2-hydroxyphenyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 129105717 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [5-(2,2-dimethylpropanoyloxy)-2-hydroxyphenyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)Oc1cc(OC(=O)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C16H22O5/c1-6-10(2)14(18)21-13-9-11(7-8-12(13)17)20-15(19)16(3,4)5/h7-10,17H,6H2,1-5H3 |
| InChIKey | WLHAQIDNUSOXPG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|