About (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate
(2,5-dihydroxyphenyl) (2S)-2-aminopropanoate (PubChem CID 90946685) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate |
| PubChem CID | 90946685 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)Oc1cc(O)ccc1O |
| InChI | InChI=1S/C9H11NO4/c1-5(10)9(13)14-8-4-6(11)2-3-7(8)12/h2-5,11-12H,10H2,1H3/t5-/m0/s1 |
| InChIKey | URIXPJNLBRYEQD-YFKPBYRVSA-N |
| XLogP | 0.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate?
The IUPAC name of (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate (CID 90946685) is (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate.
What is the SMILES notation for (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate?
The canonical SMILES for (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate is C[C@H](N)C(=O)Oc1cc(O)ccc1O.
What is the InChIKey of (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate?
The InChIKey is URIXPJNLBRYEQD-YFKPBYRVSA-N. The full InChI is InChI=1S/C9H11NO4/c1-5(10)9(13)14-8-4-6(11)2-3-7(8)12/h2-5,11-12H,10H2,1H3/t5-/m0/s1.
What are the key properties of (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate?
(2,5-dihydroxyphenyl) (2S)-2-aminopropanoate has a molecular weight of 197.19 g/mol, XLogP of 0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxyphenyl) (2S)-2-aminopropanoate is sourced from PubChem (CID 90946685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).