C25H26O6 — CID 38363112
[5-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]-2-hydroxyphenyl] 4-hydroxybenzoate (PubChem CID 38363112) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is [5-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]-2-hydroxyphenyl] 4-hydroxybenzoate.
| Compound Name | [5-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]-2-hydroxyphenyl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 38363112 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [5-[(2S,3R)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]-2-hydroxyphenyl] 4-hydroxybenzoate |
| SMILES | C[C@H](Cc1ccc(O)c(O)c1)[C@@H](C)Cc1ccc(O)c(OC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H26O6/c1-15(11-17-3-9-21(27)23(29)13-17)16(2)12-18-4-10-22(28)24(14-18)31-25(30)19-5-7-20(26)8-6-19/h3-10,13-16,26-29H,11-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | ORMBYUPZHHWUEM-CVEARBPZSA-N |
| XLogP | 4.79 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|