C20H14O8 — CID 59350326
[2-(3,4-dihydroxybenzoyl)oxyphenyl] 3,4-dihydroxybenzoate (PubChem CID 59350326) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is [2-(3,4-dihydroxybenzoyl)oxyphenyl] 3,4-dihydroxybenzoate.
| Compound Name | [2-(3,4-dihydroxybenzoyl)oxyphenyl] 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 59350326 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [2-(3,4-dihydroxybenzoyl)oxyphenyl] 3,4-dihydroxybenzoate |
| SMILES | O=C(Oc1ccccc1OC(=O)c1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H14O8/c21-13-7-5-11(9-15(13)23)19(25)27-17-3-1-2-4-18(17)28-20(26)12-6-8-14(22)16(24)10-12/h1-10,21-24H |
| InChIKey | YEZSMURHRUWUQE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|