C35H22O12 — CID 22903186
[1,10-bis[(3,4-dihydroxybenzoyl)oxy]anthracen-2-yl] 3,4-dihydroxybenzoate (PubChem CID 22903186) has the molecular formula C35H22O12 and a molecular weight of 634.55 g/mol. Its IUPAC name is [1,10-bis[(3,4-dihydroxybenzoyl)oxy]anthracen-2-yl] 3,4-dihydroxybenzoate.
| Compound Name | [1,10-bis[(3,4-dihydroxybenzoyl)oxy]anthracen-2-yl] 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 22903186 |
| Molecular Formula | C35H22O12 |
| Molecular Weight | 634.55 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | [1,10-bis[(3,4-dihydroxybenzoyl)oxy]anthracen-2-yl] 3,4-dihydroxybenzoate |
| SMILES | O=C(Oc1ccc2c(OC(=O)c3ccc(O)c(O)c3)c3ccccc3cc2c1OC(=O)c1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C35H22O12/c36-24-9-5-18(14-27(24)39)33(42)45-30-12-8-22-23(32(30)47-35(44)20-7-11-26(38)29(41)16-20)13-17-3-1-2-4-21(17)31(22)46-34(43)19-6-10-25(37)28(40)15-19/h1-16,36-41H |
| InChIKey | FXFVSZHSFSQPCU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|