C21H16O5 — CID 23738197
(2-oxo-1,2-diphenylethyl) 3,4-dihydroxybenzoate (PubChem CID 23738197) has the molecular formula C21H16O5 and a molecular weight of 348.35 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3,4-dihydroxybenzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 23738197 |
| Molecular Formula | C21H16O5 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3,4-dihydroxybenzoate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H16O5/c22-17-12-11-16(13-18(17)23)21(25)26-20(15-9-5-2-6-10-15)19(24)14-7-3-1-4-8-14/h1-13,20,22-23H |
| InChIKey | GYJNSKSBWRSGNQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|