C17H19NO4 — CID 123278251
[2-(methylamino)-1-phenylpropyl] 3,4-dihydroxybenzoate (PubChem CID 123278251) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [2-(methylamino)-1-phenylpropyl] 3,4-dihydroxybenzoate.
| Compound Name | [2-(methylamino)-1-phenylpropyl] 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 123278251 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [2-(methylamino)-1-phenylpropyl] 3,4-dihydroxybenzoate |
| SMILES | CNC(C)C(OC(=O)c1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-11(18-2)16(12-6-4-3-5-7-12)22-17(21)13-8-9-14(19)15(20)10-13/h3-11,16,18-20H,1-2H3 |
| InChIKey | QMVYCUFBVBZUBK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|