C21H27NO2 — CID 89434559
[(1S,2R)-2-(methylamino)-1-phenylpropyl] 4-tert-butylbenzoate (PubChem CID 89434559) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is [(1S,2R)-2-(methylamino)-1-phenylpropyl] 4-tert-butylbenzoate.
| Compound Name | [(1S,2R)-2-(methylamino)-1-phenylpropyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 89434559 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | [(1S,2R)-2-(methylamino)-1-phenylpropyl] 4-tert-butylbenzoate |
| SMILES | CN[C@H](C)[C@@H](OC(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-15(22-5)19(16-9-7-6-8-10-16)24-20(23)17-11-13-18(14-12-17)21(2,3)4/h6-15,19,22H,1-5H3/t15-,19-/m1/s1 |
| InChIKey | VLFJIPYJAYXBRD-DNVCBOLYSA-N |
| XLogP | 4.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |