C22H17F3O3 — CID 12002871
[(1R,2R)-2-hydroxy-1,2-diphenylethyl] 4-(trifluoromethyl)benzoate (PubChem CID 12002871) has the molecular formula C22H17F3O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-1,2-diphenylethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(1R,2R)-2-hydroxy-1,2-diphenylethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 12002871 |
| Molecular Formula | C22H17F3O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(1R,2R)-2-hydroxy-1,2-diphenylethyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(O[C@H](c1ccccc1)[C@H](O)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F3O3/c23-22(24,25)18-13-11-17(12-14-18)21(27)28-20(16-9-5-2-6-10-16)19(26)15-7-3-1-4-8-15/h1-14,19-20,26H/t19-,20-/m1/s1 |
| InChIKey | BOEIBIAIXIAMKJ-WOJBJXKFSA-N |
| XLogP | 5.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |