C22H21F3O3 — CID 44551800
[(1E,3Z)-2-methyl-1-[(1S)-1-phenylethoxy]penta-1,3-dien-3-yl] 4-(trifluoromethyl)benzoate (PubChem CID 44551800) has the molecular formula C22H21F3O3 and a molecular weight of 390.40 g/mol. Its IUPAC name is [(1E,3Z)-2-methyl-1-[(1S)-1-phenylethoxy]penta-1,3-dien-3-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(1E,3Z)-2-methyl-1-[(1S)-1-phenylethoxy]penta-1,3-dien-3-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 44551800 |
| Molecular Formula | C22H21F3O3 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [(1E,3Z)-2-methyl-1-[(1S)-1-phenylethoxy]penta-1,3-dien-3-yl] 4-(trifluoromethyl)benzoate |
| SMILES | C/C=C(OC(=O)c1ccc(C(F)(F)F)cc1)/C(C)=C/O[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H21F3O3/c1-4-20(15(2)14-27-16(3)17-8-6-5-7-9-17)28-21(26)18-10-12-19(13-11-18)22(23,24)25/h4-14,16H,1-3H3/b15-14+,20-4-/t16-/m0/s1 |
| InChIKey | YAYLJCHAKDHKMZ-QUEFHPKDSA-N |
| XLogP | 6.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|