C30H26O3 — CID 102467284
[(E,1R,2R)-2-[(S)-hydroxy(phenyl)methyl]-1,4-diphenylbut-3-enyl] benzoate (PubChem CID 102467284) has the molecular formula C30H26O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is [(E,1R,2R)-2-[(S)-hydroxy(phenyl)methyl]-1,4-diphenylbut-3-enyl] benzoate.
| Compound Name | [(E,1R,2R)-2-[(S)-hydroxy(phenyl)methyl]-1,4-diphenylbut-3-enyl] benzoate |
|---|---|
| PubChem CID | 102467284 |
| Molecular Formula | C30H26O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(E,1R,2R)-2-[(S)-hydroxy(phenyl)methyl]-1,4-diphenylbut-3-enyl] benzoate |
| SMILES | O=C(O[C@@H](c1ccccc1)[C@H](/C=C/c1ccccc1)[C@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H26O3/c31-28(24-15-7-2-8-16-24)27(22-21-23-13-5-1-6-14-23)29(25-17-9-3-10-18-25)33-30(32)26-19-11-4-12-20-26/h1-22,27-29,31H/b22-21+/t27-,28-,29+/m1/s1 |
| InChIKey | MRDLTOPQVHFDFZ-OBIFSLSDSA-N |
| XLogP | 6.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |