C22H26O3 — CID 102467278
[(E,3R,4R)-4-[(S)-hydroxy(phenyl)methyl]-6-phenylhex-5-en-3-yl] propanoate (PubChem CID 102467278) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [(E,3R,4R)-4-[(S)-hydroxy(phenyl)methyl]-6-phenylhex-5-en-3-yl] propanoate.
| Compound Name | [(E,3R,4R)-4-[(S)-hydroxy(phenyl)methyl]-6-phenylhex-5-en-3-yl] propanoate |
|---|---|
| PubChem CID | 102467278 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [(E,3R,4R)-4-[(S)-hydroxy(phenyl)methyl]-6-phenylhex-5-en-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC)[C@H](/C=C/c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H26O3/c1-3-20(25-21(23)4-2)19(16-15-17-11-7-5-8-12-17)22(24)18-13-9-6-10-14-18/h5-16,19-20,22,24H,3-4H2,1-2H3/b16-15+/t19-,20+,22+/m0/s1 |
| InChIKey | BNTCDYSSRCHZBD-HMHISHPUSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |