C32H46O3 — CID 102467280
[(E,3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-1-phenylundec-1-en-4-yl] octanoate (PubChem CID 102467280) has the molecular formula C32H46O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is [(E,3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-1-phenylundec-1-en-4-yl] octanoate.
| Compound Name | [(E,3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-1-phenylundec-1-en-4-yl] octanoate |
|---|---|
| PubChem CID | 102467280 |
| Molecular Formula | C32H46O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | [(E,3R,4R)-3-[(S)-hydroxy(phenyl)methyl]-1-phenylundec-1-en-4-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H](CCCCCCC)[C@H](/C=C/c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C32H46O3/c1-3-5-7-9-17-23-30(35-31(33)24-18-10-8-6-4-2)29(26-25-27-19-13-11-14-20-27)32(34)28-21-15-12-16-22-28/h11-16,19-22,25-26,29-30,32,34H,3-10,17-18,23-24H2,1-2H3/b26-25+/t29-,30+,32+/m0/s1 |
| InChIKey | LWAGIIUNHHTVOK-OODMXSLYSA-N |
| XLogP | 8.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|