C16H20Cl2O2 — CID 10380966
(E)-4,4-dichloro-3-hydroxy-1-phenyldec-1-en-5-one (PubChem CID 10380966) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is (E)-4,4-dichloro-3-hydroxy-1-phenyldec-1-en-5-one.
| Compound Name | (E)-4,4-dichloro-3-hydroxy-1-phenyldec-1-en-5-one |
|---|---|
| PubChem CID | 10380966 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (E)-4,4-dichloro-3-hydroxy-1-phenyldec-1-en-5-one |
| SMILES | CCCCCC(=O)C(Cl)(Cl)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H20Cl2O2/c1-2-3-5-10-14(19)16(17,18)15(20)12-11-13-8-6-4-7-9-13/h4,6-9,11-12,15,20H,2-3,5,10H2,1H3/b12-11+ |
| InChIKey | WTVQONQXFCCWAO-VAWYXSNFSA-N |
| XLogP | 4.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|