C26H26O2 — CID 101260855
[(E)-1,3-diphenylprop-2-enyl] 4-tert-butylbenzoate (PubChem CID 101260855) has the molecular formula C26H26O2 and a molecular weight of 370.49 g/mol. Its IUPAC name is [(E)-1,3-diphenylprop-2-enyl] 4-tert-butylbenzoate.
| Compound Name | [(E)-1,3-diphenylprop-2-enyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 101260855 |
| Molecular Formula | C26H26O2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(E)-1,3-diphenylprop-2-enyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OC(/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O2/c1-26(2,3)23-17-15-22(16-18-23)25(27)28-24(21-12-8-5-9-13-21)19-14-20-10-6-4-7-11-20/h4-19,24H,1-3H3/b19-14+ |
| InChIKey | DSYYJULHGTXAQQ-XMHGGMMESA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |