C18H19NO4 — CID 89434507
2-[(1S,2R)-2-(methylamino)-1-phenylpropoxy]carbonylbenzoic acid (PubChem CID 89434507) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[(1S,2R)-2-(methylamino)-1-phenylpropoxy]carbonylbenzoic acid.
| Compound Name | 2-[(1S,2R)-2-(methylamino)-1-phenylpropoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 89434507 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[(1S,2R)-2-(methylamino)-1-phenylpropoxy]carbonylbenzoic acid |
| SMILES | CN[C@H](C)[C@@H](OC(=O)c1ccccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO4/c1-12(19-2)16(13-8-4-3-5-9-13)23-18(22)15-11-7-6-10-14(15)17(20)21/h3-12,16,19H,1-2H3,(H,20,21)/t12-,16-/m1/s1 |
| InChIKey | MJJZGDSHKPODBD-MLGOLLRUSA-N |
| XLogP | 2.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |