C16H25NO7 — CID 144550419
[(2R)-2-(methylamino)-1-phenylpropyl] 2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 144550419) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(2R)-2-(methylamino)-1-phenylpropyl] 2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [(2R)-2-(methylamino)-1-phenylpropyl] 2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 144550419 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(2R)-2-(methylamino)-1-phenylpropyl] 2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CN[C@H](C)C(OC(=O)C(O)C(O)C(O)C(O)CO)c1ccccc1 |
| InChI | InChI=1S/C16H25NO7/c1-9(17-2)15(10-6-4-3-5-7-10)24-16(23)14(22)13(21)12(20)11(19)8-18/h3-7,9,11-15,17-22H,8H2,1-2H3/t9-,11?,12?,13?,14?,15?/m1/s1 |
| InChIKey | DJKVBXLONXHJOV-DBIAKFMCSA-N |
| XLogP | -1.69 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |