C17H21NO4 — CID 53463041
2-hydroxybenzoic acid;2-(methylamino)-1-phenylpropan-1-ol (PubChem CID 53463041) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;2-(methylamino)-1-phenylpropan-1-ol.
| Compound Name | 2-hydroxybenzoic acid;2-(methylamino)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 53463041 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-hydroxybenzoic acid;2-(methylamino)-1-phenylpropan-1-ol |
| SMILES | CNC(C)C(O)c1ccccc1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C10H15NO.C7H6O3/c1-8(11-2)10(12)9-6-4-3-5-7-9;8-6-4-2-1-3-5(6)7(9)10/h3-8,10-12H,1-2H3;1-4,8H,(H,9,10) |
| InChIKey | XPBWFIUTLFAFKC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |