C10H15CuNO — CID 90401537
copper;(1R,2R)-2-(methylamino)-1-phenylpropan-1-ol (PubChem CID 90401537) has the molecular formula C10H15CuNO and a molecular weight of 228.78 g/mol. Its IUPAC name is copper;(1R,2R)-2-(methylamino)-1-phenylpropan-1-ol.
| Compound Name | copper;(1R,2R)-2-(methylamino)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 90401537 |
| Molecular Formula | C10H15CuNO |
| Molecular Weight | 228.78 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | copper;(1R,2R)-2-(methylamino)-1-phenylpropan-1-ol |
| SMILES | CN[C@H](C)[C@H](O)c1ccccc1.[Cu] |
| InChI | InChI=1S/C10H15NO.Cu/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;/t8-,10+;/m1./s1 |
| InChIKey | ZSDPWOLZHKTVNS-SCYNACPDSA-N |
| XLogP | 1.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.78 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |