C10H17NOS — CID 162055565
(1R,2S)-2-(methylamino)-1-phenylpropan-1-ol;sulfane (PubChem CID 162055565) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol;sulfane.
| Compound Name | (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol;sulfane |
|---|---|
| PubChem CID | 162055565 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (1R,2S)-2-(methylamino)-1-phenylpropan-1-ol;sulfane |
| SMILES | CN[C@@H](C)[C@H](O)c1ccccc1.S |
| InChI | InChI=1S/C10H15NO.H2S/c1-8(11-2)10(12)9-6-4-3-5-7-9;/h3-8,10-12H,1-2H3;1H2/t8-,10-;/m0./s1 |
| InChIKey | YZCZFNATXQENOE-GNAZCLTHSA-N |
| XLogP | 1.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |