C10H15NO — CID 76973466
(1S,2S)-1-phenyl-2-(trideuterio(113C)methylamino)propan-1-ol (PubChem CID 76973466) has the molecular formula C10H15NO and a molecular weight of 169.25 g/mol. Its IUPAC name is (1S,2S)-1-phenyl-2-(trideuterio(113C)methylamino)propan-1-ol.
| Compound Name | (1S,2S)-1-phenyl-2-(trideuterio(113C)methylamino)propan-1-ol |
|---|---|
| PubChem CID | 76973466 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | (1S,2S)-1-phenyl-2-(trideuterio(113C)methylamino)propan-1-ol |
| SMILES | [2H][13C]([2H])([2H])N[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H15NO/c1-8(11-2)10(12)9-6-4-3-5-7-9/h3-8,10-12H,1-2H3/t8-,10+/m0/s1/i2+1D3 |
| InChIKey | KWGRBVOPPLSCSI-QLBWOADNSA-N |
| XLogP | 1.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |