C21H17NO3 — CID 46552586
(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate (PubChem CID 46552586) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 46552586 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C21H17NO3/c1-15-12-13-18(14-22-15)21(24)25-20(17-10-6-3-7-11-17)19(23)16-8-4-2-5-9-16/h2-14,20H,1H3 |
| InChIKey | FXOKAEJZCMXPLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |