(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate

C21H17NO3 — CID 46552586

IUPAC(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate
SMILESCc1ccc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)cn1
InChIInChI=1S/C21H17NO3/c1-15-12-13-18(14-22-15)21(24)25-20(17-10-6-3-7-11-17)19(23)16-8-4-2-5-9-16/h2-14,20H,1H3
InChIKeyFXOKAEJZCMXPLD-UHFFFAOYSA-N
MW331.37 g/mol
LogP4.17
Rot. Bonds5

About (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate

(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate (PubChem CID 46552586) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate.

Molecular Properties

Compound Name(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate
PubChem CID46552586
Molecular FormulaC21H17NO3
Molecular Weight331.37 g/mol
Exact Mass331.12
IUPAC Name(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate
SMILESCc1ccc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)cn1
InChIInChI=1S/C21H17NO3/c1-15-12-13-18(14-22-15)21(24)25-20(17-10-6-3-7-11-17)19(23)16-8-4-2-5-9-16/h2-14,20H,1H3
InChIKeyFXOKAEJZCMXPLD-UHFFFAOYSA-N
XLogP4.17
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.37
LogP ≤ 54.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate?
The IUPAC name of (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate (CID 46552586) is (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate.
What is the SMILES notation for (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate?
The canonical SMILES for (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate is Cc1ccc(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)cn1.
What is the InChIKey of (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate?
The InChIKey is FXOKAEJZCMXPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO3/c1-15-12-13-18(14-22-15)21(24)25-20(17-10-6-3-7-11-17)19(23)16-8-4-2-5-9-16/h2-14,20H,1H3.
What are the key properties of (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate?
(2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate has a molecular weight of 331.37 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1,2-diphenylethyl) 6-methylpyridine-3-carboxylate is sourced from PubChem (CID 46552586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).