C21H14BrNO5 — CID 1336717
[(1R)-2-oxo-1,2-diphenylethyl] 4-bromo-3-nitrobenzoate (PubChem CID 1336717) has the molecular formula C21H14BrNO5 and a molecular weight of 440.25 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 4-bromo-3-nitrobenzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-bromo-3-nitrobenzoate |
|---|---|
| PubChem CID | 1336717 |
| Molecular Formula | C21H14BrNO5 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-bromo-3-nitrobenzoate |
| SMILES | O=C(O[C@@H](C(=O)c1ccccc1)c1ccccc1)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14BrNO5/c22-17-12-11-16(13-18(17)23(26)27)21(25)28-20(15-9-5-2-6-10-15)19(24)14-7-3-1-4-8-14/h1-13,20H/t20-/m1/s1 |
| InChIKey | OHUZSSSCEGHIIB-HXUWFJFHSA-N |
| XLogP | 5.14 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|