C26H30O4 — CID 21290516
4-[4-[3-hydroxy-4-[(4-methylphenyl)methoxy]phenyl]-2,3-dimethylbutyl]benzene-1,2-diol (PubChem CID 21290516) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 4-[4-[3-hydroxy-4-[(4-methylphenyl)methoxy]phenyl]-2,3-dimethylbutyl]benzene-1,2-diol.
| Compound Name | 4-[4-[3-hydroxy-4-[(4-methylphenyl)methoxy]phenyl]-2,3-dimethylbutyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 21290516 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-[4-[3-hydroxy-4-[(4-methylphenyl)methoxy]phenyl]-2,3-dimethylbutyl]benzene-1,2-diol |
| SMILES | Cc1ccc(COc2ccc(CC(C)C(C)Cc3ccc(O)c(O)c3)cc2O)cc1 |
| InChI | InChI=1S/C26H30O4/c1-17-4-6-20(7-5-17)16-30-26-11-9-22(15-25(26)29)13-19(3)18(2)12-21-8-10-23(27)24(28)14-21/h4-11,14-15,18-19,27-29H,12-13,16H2,1-3H3 |
| InChIKey | DHVJTVJAZNXXHH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|