C18H23NO4 — CID 122490663
4-[4-(4-aminooxy-3-hydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol (PubChem CID 122490663) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[4-(4-aminooxy-3-hydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol.
| Compound Name | 4-[4-(4-aminooxy-3-hydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 122490663 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[4-(4-aminooxy-3-hydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(ON)c(O)c1 |
| InChI | InChI=1S/C18H23NO4/c1-11(7-13-3-5-15(20)16(21)9-13)12(2)8-14-4-6-18(23-19)17(22)10-14/h3-6,9-12,20-22H,7-8,19H2,1-2H3 |
| InChIKey | OXKBYKMWZFELDZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|