C18H27NO5 — CID 91466228
[5-[(1S)-2-amino-1-(2,2-dimethylpropanoyloxy)ethyl]-2-hydroxyphenyl] 2,2-dimethylpropanoate (PubChem CID 91466228) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is [5-[(1S)-2-amino-1-(2,2-dimethylpropanoyloxy)ethyl]-2-hydroxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [5-[(1S)-2-amino-1-(2,2-dimethylpropanoyloxy)ethyl]-2-hydroxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 91466228 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [5-[(1S)-2-amino-1-(2,2-dimethylpropanoyloxy)ethyl]-2-hydroxyphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc([C@@H](CN)OC(=O)C(C)(C)C)ccc1O |
| InChI | InChI=1S/C18H27NO5/c1-17(2,3)15(21)23-13-9-11(7-8-12(13)20)14(10-19)24-16(22)18(4,5)6/h7-9,14,20H,10,19H2,1-6H3/t14-/m1/s1 |
| InChIKey | MEPYWONCESLVEB-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|