C18H29NO6S — CID 88754012
[4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-hydroxyphenyl] 2,2-dimethylpropanoate (PubChem CID 88754012) has the molecular formula C18H29NO6S and a molecular weight of 387.50 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-hydroxyphenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-hydroxyphenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88754012 |
| Molecular Formula | C18H29NO6S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-hydroxyphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(OS(C)(=O)=O)C(N)C(C)(C)C)cc1O |
| InChI | InChI=1S/C18H29NO6S/c1-17(2,3)15(19)14(25-26(7,22)23)11-8-9-13(12(20)10-11)24-16(21)18(4,5)6/h8-10,14-15,20H,19H2,1-7H3 |
| InChIKey | QBWKLZYYEYKRMN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|