C24H39NO7S — CID 88754137
[5-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(2,2-dimethylpropanoyloxy)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 88754137) has the molecular formula C24H39NO7S and a molecular weight of 485.64 g/mol. Its IUPAC name is [5-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(2,2-dimethylpropanoyloxy)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [5-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(2,2-dimethylpropanoyloxy)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88754137 |
| Molecular Formula | C24H39NO7S |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [5-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(2,2-dimethylpropanoyloxy)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCc1cc(C(OS(C)(=O)=O)C(N)C(C)(C)C)ccc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H39NO7S/c1-22(2,3)19(25)18(32-33(10,28)29)15-11-12-17(31-21(27)24(7,8)9)16(13-15)14-30-20(26)23(4,5)6/h11-13,18-19H,14,25H2,1-10H3 |
| InChIKey | XBFWPILHEFRJSB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|