C31H37NO7S — CID 88754584
[4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(3,4-dimethylbenzoyl)oxyphenyl] 3,4-dimethylbenzoate (PubChem CID 88754584) has the molecular formula C31H37NO7S and a molecular weight of 567.70 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(3,4-dimethylbenzoyl)oxyphenyl] 3,4-dimethylbenzoate.
| Compound Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(3,4-dimethylbenzoyl)oxyphenyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 88754584 |
| Molecular Formula | C31H37NO7S |
| Molecular Weight | 567.70 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-(3,4-dimethylbenzoyl)oxyphenyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(OS(C)(=O)=O)C(N)C(C)(C)C)cc2OC(=O)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C31H37NO7S/c1-18-9-11-23(15-20(18)3)29(33)37-25-14-13-22(27(39-40(8,35)36)28(32)31(5,6)7)17-26(25)38-30(34)24-12-10-19(2)21(4)16-24/h9-17,27-28H,32H2,1-8H3 |
| InChIKey | XHSNEYMVIIHRBB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|