C30H35NO7S — CID 88754474
[4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[(4-methylbenzoyl)oxymethyl]phenyl] 3-methylbenzoate (PubChem CID 88754474) has the molecular formula C30H35NO7S and a molecular weight of 553.68 g/mol. Its IUPAC name is [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[(4-methylbenzoyl)oxymethyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[(4-methylbenzoyl)oxymethyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 88754474 |
| Molecular Formula | C30H35NO7S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | [4-(2-amino-3,3-dimethyl-1-methylsulfonyloxybutyl)-2-[(4-methylbenzoyl)oxymethyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2cc(C(OS(C)(=O)=O)C(N)C(C)(C)C)ccc2OC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H35NO7S/c1-19-10-12-21(13-11-19)28(32)36-18-24-17-22(26(38-39(6,34)35)27(31)30(3,4)5)14-15-25(24)37-29(33)23-9-7-8-20(2)16-23/h7-17,26-27H,18,31H2,1-6H3 |
| InChIKey | FGFLQMKTSPGDSD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|