About (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate
(2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate (PubChem CID 8955135) has the molecular formula C17H18O5S
and a molecular weight of 334.39 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate |
| PubChem CID | 8955135 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate |
| SMILES | COc1ccc(C)cc1COC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18O5S/c1-12-4-9-16(21-2)14(10-12)11-22-17(18)13-5-7-15(8-6-13)23(3,19)20/h4-10H,11H2,1-3H3 |
| InChIKey | AMBJMHXSMTUHLN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate?
The IUPAC name of (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate (CID 8955135) is (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate.
What is the SMILES notation for (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate?
The canonical SMILES for (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate is COc1ccc(C)cc1COC(=O)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate?
The InChIKey is AMBJMHXSMTUHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O5S/c1-12-4-9-16(21-2)14(10-12)11-22-17(18)13-5-7-15(8-6-13)23(3,19)20/h4-10H,11H2,1-3H3.
What are the key properties of (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate?
(2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate has a molecular weight of 334.39 g/mol, XLogP of 2.76, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-5-methylphenyl)methyl 4-methylsulfonylbenzoate is sourced from PubChem (CID 8955135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).