C16H16O5 — CID 8954351
(2-methoxy-5-methylphenyl)methyl 2,4-dihydroxybenzoate (PubChem CID 8954351) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 2,4-dihydroxybenzoate.
| Compound Name | (2-methoxy-5-methylphenyl)methyl 2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 8954351 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 2,4-dihydroxybenzoate |
| SMILES | COc1ccc(C)cc1COC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H16O5/c1-10-3-6-15(20-2)11(7-10)9-21-16(19)13-5-4-12(17)8-14(13)18/h3-8,17-18H,9H2,1-2H3 |
| InChIKey | JTSPRGXMMWTFIU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |