C15H11Cl4NO3 — CID 7628172
(2-methoxy-5-methylphenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 7628172) has the molecular formula C15H11Cl4NO3 and a molecular weight of 395.07 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | (2-methoxy-5-methylphenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7628172 |
| Molecular Formula | C15H11Cl4NO3 |
| Molecular Weight | 395.07 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | COc1ccc(C)cc1COC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl4NO3/c1-7-3-4-9(22-2)8(5-7)6-23-15(21)13-11(17)10(16)12(18)14(19)20-13/h3-5H,6H2,1-2H3 |
| InChIKey | GDBVJZPCURYQKL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.07 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|