C24H18O5 — CID 8867472
(2-methoxy-5-methylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate (PubChem CID 8867472) has the molecular formula C24H18O5 and a molecular weight of 386.40 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | (2-methoxy-5-methylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 8867472 |
| Molecular Formula | C24H18O5 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl 9,10-dioxoanthracene-1-carboxylate |
| SMILES | COc1ccc(C)cc1COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H18O5/c1-14-10-11-20(28-2)15(12-14)13-29-24(27)19-9-5-8-18-21(19)23(26)17-7-4-3-6-16(17)22(18)25/h3-12H,13H2,1-2H3 |
| InChIKey | OAJYRVDTPLRTQM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|