C16H14Cl2O5S — CID 27529077
(5-chloro-2-methoxyphenyl)methyl 4-chloro-3-methylsulfonylbenzoate (PubChem CID 27529077) has the molecular formula C16H14Cl2O5S and a molecular weight of 389.26 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 27529077 |
| Molecular Formula | C16H14Cl2O5S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl 4-chloro-3-methylsulfonylbenzoate |
| SMILES | COc1ccc(Cl)cc1COC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H14Cl2O5S/c1-22-14-6-4-12(17)7-11(14)9-23-16(19)10-3-5-13(18)15(8-10)24(2,20)21/h3-8H,9H2,1-2H3 |
| InChIKey | MYBYDODKESAHPN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |