C18H14ClNO5 — CID 27478473
(5-chloro-2-methoxyphenyl)methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 27478473) has the molecular formula C18H14ClNO5 and a molecular weight of 359.77 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 27478473 |
| Molecular Formula | C18H14ClNO5 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(Cl)cc1COC(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C18H14ClNO5/c1-20-16(21)13-5-3-10(8-14(13)17(20)22)18(23)25-9-11-7-12(19)4-6-15(11)24-2/h3-8H,9H2,1-2H3 |
| InChIKey | RMUZYQUEBFODEK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|