C31H38ClNO5 — CID 70582576
[4-(3-amino-2-ethyl-1-hydroxy-4,4-dimethylpentyl)-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride (PubChem CID 70582576) has the molecular formula C31H38ClNO5 and a molecular weight of 540.10 g/mol. Its IUPAC name is [4-(3-amino-2-ethyl-1-hydroxy-4,4-dimethylpentyl)-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride.
| Compound Name | [4-(3-amino-2-ethyl-1-hydroxy-4,4-dimethylpentyl)-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 70582576 |
| Molecular Formula | C31H38ClNO5 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | [4-(3-amino-2-ethyl-1-hydroxy-4,4-dimethylpentyl)-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride |
| SMILES | CCC(C(O)c1ccc(OC(=O)c2ccc(C)cc2)c(OC(=O)c2ccc(C)cc2)c1)C(N)C(C)(C)C.Cl |
| InChI | InChI=1S/C31H37NO5.ClH/c1-7-24(28(32)31(4,5)6)27(33)23-16-17-25(36-29(34)21-12-8-19(2)9-13-21)26(18-23)37-30(35)22-14-10-20(3)11-15-22;/h8-18,24,27-28,33H,7,32H2,1-6H3;1H |
| InChIKey | VRPOGXZHANWAPR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|