C31H36ClNO5 — CID 70552294
[4-[2-(cyclopentylamino)-1-hydroxybutyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride (PubChem CID 70552294) has the molecular formula C31H36ClNO5 and a molecular weight of 538.08 g/mol. Its IUPAC name is [4-[2-(cyclopentylamino)-1-hydroxybutyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride.
| Compound Name | [4-[2-(cyclopentylamino)-1-hydroxybutyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 70552294 |
| Molecular Formula | C31H36ClNO5 |
| Molecular Weight | 538.08 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | [4-[2-(cyclopentylamino)-1-hydroxybutyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate;hydrochloride |
| SMILES | CCC(NC1CCCC1)C(O)c1ccc(OC(=O)c2ccc(C)cc2)c(OC(=O)c2ccc(C)cc2)c1.Cl |
| InChI | InChI=1S/C31H35NO5.ClH/c1-4-26(32-25-7-5-6-8-25)29(33)24-17-18-27(36-30(34)22-13-9-20(2)10-14-22)28(19-24)37-31(35)23-15-11-21(3)12-16-23;/h9-19,25-26,29,32-33H,4-8H2,1-3H3;1H |
| InChIKey | NXNVCCKZFJNLFN-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.08 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|