C33H39NO5 — CID 70553079
[4-[2-(cyclohexylamino)-1-hydroxypentyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate (PubChem CID 70553079) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is [4-[2-(cyclohexylamino)-1-hydroxypentyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[2-(cyclohexylamino)-1-hydroxypentyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 70553079 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | [4-[2-(cyclohexylamino)-1-hydroxypentyl]-2-(4-methylbenzoyl)oxyphenyl] 4-methylbenzoate |
| SMILES | CCCC(NC1CCCCC1)C(O)c1ccc(OC(=O)c2ccc(C)cc2)c(OC(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C33H39NO5/c1-4-8-28(34-27-9-6-5-7-10-27)31(35)26-19-20-29(38-32(36)24-15-11-22(2)12-16-24)30(21-26)39-33(37)25-17-13-23(3)14-18-25/h11-21,27-28,31,34-35H,4-10H2,1-3H3 |
| InChIKey | DOBMNRAEAFDIMN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|