C25H37NO5 — CID 13080789
[4-[2-(cyclopentylamino)butanoyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate (PubChem CID 13080789) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is [4-[2-(cyclopentylamino)butanoyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate.
| Compound Name | [4-[2-(cyclopentylamino)butanoyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 13080789 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | [4-[2-(cyclopentylamino)butanoyl]-2-(3-methylbutanoyloxy)phenyl] 3-methylbutanoate |
| SMILES | CCC(NC1CCCC1)C(=O)c1ccc(OC(=O)CC(C)C)c(OC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C25H37NO5/c1-6-20(26-19-9-7-8-10-19)25(29)18-11-12-21(30-23(27)13-16(2)3)22(15-18)31-24(28)14-17(4)5/h11-12,15-17,19-20,26H,6-10,13-14H2,1-5H3 |
| InChIKey | XYRGESIWQNWGBE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|