C15H18FNO4 — CID 82349976
methyl 3-(cyclopropylamino)-4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoate (PubChem CID 82349976) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is methyl 3-(cyclopropylamino)-4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoate.
| Compound Name | methyl 3-(cyclopropylamino)-4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 82349976 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 3-(cyclopropylamino)-4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CC(NC1CC1)C(=O)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C15H18FNO4/c1-20-13-6-3-9(7-11(13)16)15(19)12(8-14(18)21-2)17-10-4-5-10/h3,6-7,10,12,17H,4-5,8H2,1-2H3 |
| InChIKey | SZPRCYZMOSONCX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |